C9H9ClN2O4 — CID 70820583
3-[(5-chloro-6-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid (PubChem CID 70820583) has the molecular formula C9H9ClN2O4 and a molecular weight of 244.63 g/mol. Its IUPAC name is 3-[(5-chloro-6-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(5-chloro-6-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70820583 |
| Molecular Formula | C9H9ClN2O4 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 3-[(5-chloro-6-oxo-1H-pyridine-3-carbonyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClN2O4/c10-6-3-5(4-12-9(6)16)8(15)11-2-1-7(13)14/h3-4H,1-2H2,(H,11,15)(H,12,16)(H,13,14) |
| InChIKey | YNMWPUFHCRXPEK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |