C18H27ClN2 — CID 70821069
(3R)-3-[(5-chloro-2-piperidin-4-ylphenyl)methyl]-1-methylpiperidine (PubChem CID 70821069) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is (3R)-3-[(5-chloro-2-piperidin-4-ylphenyl)methyl]-1-methylpiperidine.
| Compound Name | (3R)-3-[(5-chloro-2-piperidin-4-ylphenyl)methyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 70821069 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3R)-3-[(5-chloro-2-piperidin-4-ylphenyl)methyl]-1-methylpiperidine |
| SMILES | CN1CCC[C@H](Cc2cc(Cl)ccc2C2CCNCC2)C1 |
| InChI | InChI=1S/C18H27ClN2/c1-21-10-2-3-14(13-21)11-16-12-17(19)4-5-18(16)15-6-8-20-9-7-15/h4-5,12,14-15,20H,2-3,6-11,13H2,1H3/t14-/m1/s1 |
| InChIKey | TXKHFEXNOOUPBK-CQSZACIVSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |