C17H34N2O — CID 70821149
3-butyl-N-[[(2S)-pyrrolidin-2-yl]methyl]octanamide (PubChem CID 70821149) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-butyl-N-[[(2S)-pyrrolidin-2-yl]methyl]octanamide.
| Compound Name | 3-butyl-N-[[(2S)-pyrrolidin-2-yl]methyl]octanamide |
|---|---|
| PubChem CID | 70821149 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 3-butyl-N-[[(2S)-pyrrolidin-2-yl]methyl]octanamide |
| SMILES | CCCCCC(CCCC)CC(=O)NC[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H34N2O/c1-3-5-7-10-15(9-6-4-2)13-17(20)19-14-16-11-8-12-18-16/h15-16,18H,3-14H2,1-2H3,(H,19,20)/t15?,16-/m0/s1 |
| InChIKey | BXBSZIXFTRXGHP-LYKKTTPLSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|