C21H36O7 — CID 70821211
15-acetyl-4,8,13-trihydroxy-5,5,7,9,13-pentamethyl-oxacyclopentadecane-2,6-dione (PubChem CID 70821211) has the molecular formula C21H36O7 and a molecular weight of 400.51 g/mol. Its IUPAC name is 15-acetyl-4,8,13-trihydroxy-5,5,7,9,13-pentamethyl-oxacyclopentadecane-2,6-dione.
| Compound Name | 15-acetyl-4,8,13-trihydroxy-5,5,7,9,13-pentamethyl-oxacyclopentadecane-2,6-dione |
|---|---|
| PubChem CID | 70821211 |
| Molecular Formula | C21H36O7 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 15-acetyl-4,8,13-trihydroxy-5,5,7,9,13-pentamethyl-oxacyclopentadecane-2,6-dione |
| SMILES | CC(=O)C1CC(C)(O)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1 |
| InChI | InChI=1S/C21H36O7/c1-12-8-7-9-21(6,27)11-15(14(3)22)28-17(24)10-16(23)20(4,5)19(26)13(2)18(12)25/h12-13,15-16,18,23,25,27H,7-11H2,1-6H3 |
| InChIKey | KJYSBGJLWSQOMG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |