About methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate
methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate (PubChem CID 70821284) has the molecular formula C10H10F3NO2
and a molecular weight of 233.19 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate |
| PubChem CID | 70821284 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate |
| SMILES | COC(=O)[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H10F3NO2/c1-16-10(15)9(14)3-5-2-7(12)8(13)4-6(5)11/h2,4,9H,3,14H2,1H3/t9-/m1/s1 |
| InChIKey | GXZNDTIDZSRMNE-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate?
The IUPAC name of methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate (CID 70821284) is methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate.
What is the SMILES notation for methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate?
The canonical SMILES for methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate is COC(=O)[C@H](N)Cc1cc(F)c(F)cc1F.
What is the InChIKey of methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate?
The InChIKey is GXZNDTIDZSRMNE-SECBINFHSA-N. The full InChI is InChI=1S/C10H10F3NO2/c1-16-10(15)9(14)3-5-2-7(12)8(13)4-6(5)11/h2,4,9H,3,14H2,1H3/t9-/m1/s1.
What are the key properties of methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate?
methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate has a molecular weight of 233.19 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-3-(2,4,5-trifluorophenyl)propanoate is sourced from PubChem (CID 70821284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).