C28H31FN2O3 — CID 70821347
(3S)-1-benzyl-3-[3-[3-fluoro-5-[(3-methoxyphenyl)methoxy]phenyl]propyl]piperazin-2-one (PubChem CID 70821347) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is (3S)-1-benzyl-3-[3-[3-fluoro-5-[(3-methoxyphenyl)methoxy]phenyl]propyl]piperazin-2-one.
| Compound Name | (3S)-1-benzyl-3-[3-[3-fluoro-5-[(3-methoxyphenyl)methoxy]phenyl]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 70821347 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (3S)-1-benzyl-3-[3-[3-fluoro-5-[(3-methoxyphenyl)methoxy]phenyl]propyl]piperazin-2-one |
| SMILES | COc1cccc(COc2cc(F)cc(CCC[C@@H]3NCCN(Cc4ccccc4)C3=O)c2)c1 |
| InChI | InChI=1S/C28H31FN2O3/c1-33-25-11-5-10-23(17-25)20-34-26-16-22(15-24(29)18-26)9-6-12-27-28(32)31(14-13-30-27)19-21-7-3-2-4-8-21/h2-5,7-8,10-11,15-18,27,30H,6,9,12-14,19-20H2,1H3/t27-/m0/s1 |
| InChIKey | MORNGUCORJUQFX-MHZLTWQESA-N |
| XLogP | 4.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |