About methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate
methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 70821566) has the molecular formula C14H18O5S
and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate.
Molecular Properties
| Compound Name | methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate |
| PubChem CID | 70821566 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)C1OC(Sc2ccccc2)C(O)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C14H18O5S/c1-8-10(15)12(13(17)18-2)19-14(11(8)16)20-9-6-4-3-5-7-9/h3-8,10-12,14-16H,1-2H3/t8-,10-,11?,12?,14?/m0/s1 |
| InChIKey | RXSGSAQFWDYOLN-ORXNNJNQSA-N |
| XLogP | 1.03 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate?
The IUPAC name of methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate (CID 70821566) is methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate.
What is the SMILES notation for methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate?
The canonical SMILES for methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate is COC(=O)C1OC(Sc2ccccc2)C(O)[C@@H](C)[C@@H]1O.
What is the InChIKey of methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate?
The InChIKey is RXSGSAQFWDYOLN-ORXNNJNQSA-N. The full InChI is InChI=1S/C14H18O5S/c1-8-10(15)12(13(17)18-2)19-14(11(8)16)20-9-6-4-3-5-7-9/h3-8,10-12,14-16H,1-2H3/t8-,10-,11?,12?,14?/m0/s1.
What are the key properties of methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate?
methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate has a molecular weight of 298.36 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,4S)-3,5-dihydroxy-4-methyl-6-phenylsulfanyloxane-2-carboxylate is sourced from PubChem (CID 70821566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).