C21H38O — CID 70821636
5a-ethyl-3,6,6,8a-tetramethyl-7-propyl-1,2,3a,4,5,7,8,8b-octahydroacenaphthylen-3-ol (PubChem CID 70821636) has the molecular formula C21H38O and a molecular weight of 306.53 g/mol. Its IUPAC name is 5a-ethyl-3,6,6,8a-tetramethyl-7-propyl-1,2,3a,4,5,7,8,8b-octahydroacenaphthylen-3-ol.
| Compound Name | 5a-ethyl-3,6,6,8a-tetramethyl-7-propyl-1,2,3a,4,5,7,8,8b-octahydroacenaphthylen-3-ol |
|---|---|
| PubChem CID | 70821636 |
| Molecular Formula | C21H38O |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 5a-ethyl-3,6,6,8a-tetramethyl-7-propyl-1,2,3a,4,5,7,8,8b-octahydroacenaphthylen-3-ol |
| SMILES | CCCC1CC2(C)CCC3C2C(CC)(CCC3(C)O)C1(C)C |
| InChI | InChI=1S/C21H38O/c1-7-9-15-14-19(5)11-10-16-17(19)21(8-2,18(15,3)4)13-12-20(16,6)22/h15-17,22H,7-14H2,1-6H3 |
| InChIKey | WTDJWARDXLSIRV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |