C28H25N5O5 — CID 70822072
ethyl 4-[2-(furan-2-carbonyl)hydrazinyl]-7-methyl-2-oxo-1,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 70822072) has the molecular formula C28H25N5O5 and a molecular weight of 511.54 g/mol. Its IUPAC name is ethyl 4-[2-(furan-2-carbonyl)hydrazinyl]-7-methyl-2-oxo-1,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-[2-(furan-2-carbonyl)hydrazinyl]-7-methyl-2-oxo-1,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 70822072 |
| Molecular Formula | C28H25N5O5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | ethyl 4-[2-(furan-2-carbonyl)hydrazinyl]-7-methyl-2-oxo-1,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2c(c(NNC(=O)c3ccco3)nc(=O)n2-c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C28H25N5O5/c1-3-37-27(35)21-17(2)29-25-23(22(21)18-11-6-4-7-12-18)24(31-32-26(34)20-15-10-16-38-20)30-28(36)33(25)19-13-8-5-9-14-19/h4-16,22,29H,3H2,1-2H3,(H,32,34)(H,30,31,36) |
| InChIKey | UTTDHXJMPYDVJX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|