C22H18N4O3 — CID 70822128
5-methyl-8,13-diphenyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione (PubChem CID 70822128) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 5-methyl-8,13-diphenyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione.
| Compound Name | 5-methyl-8,13-diphenyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
|---|---|
| PubChem CID | 70822128 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-methyl-8,13-diphenyl-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene-6,10,12-trione |
| SMILES | CN1CC2=C(C1=O)C(c1ccccc1)c1c(n(-c3ccccc3)c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C22H18N4O3/c1-25-12-15-17(21(25)28)16(13-8-4-2-5-9-13)18-19(23-15)26(22(29)24-20(18)27)14-10-6-3-7-11-14/h2-11,16,23H,12H2,1H3,(H,24,27,29) |
| InChIKey | SNULEDYBIBWRCU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |