C20H23FN2 — CID 70822346
5-(6-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-1,3-dien-1-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine (PubChem CID 70822346) has the molecular formula C20H23FN2 and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-(6-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-1,3-dien-1-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine.
| Compound Name | 5-(6-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-1,3-dien-1-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine |
|---|---|
| PubChem CID | 70822346 |
| Molecular Formula | C20H23FN2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 5-(6-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-1,3-dien-1-yl)-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine |
| SMILES | FC1=CC=C(C2CCCCc3cncn32)C(C2=CCCC=C2)C1 |
| InChI | InChI=1S/C20H23FN2/c21-16-10-11-18(19(12-16)15-6-2-1-3-7-15)20-9-5-4-8-17-13-22-14-23(17)20/h2,6-7,10-11,13-14,19-20H,1,3-5,8-9,12H2 |
| InChIKey | CYCFKQVNRRKFAY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |