C21H23F3N2 — CID 70822381
5-[6-[2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,3-dien-1-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine (PubChem CID 70822381) has the molecular formula C21H23F3N2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 5-[6-[2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,3-dien-1-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine.
| Compound Name | 5-[6-[2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,3-dien-1-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine |
|---|---|
| PubChem CID | 70822381 |
| Molecular Formula | C21H23F3N2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5-[6-[2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]cyclohexa-1,3-dien-1-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine |
| SMILES | FC(F)(F)C1=C(C2CC=CC=C2C2CCCCc3cncn32)C=CCC1 |
| InChI | InChI=1S/C21H23F3N2/c22-21(23,24)19-11-5-4-9-17(19)16-8-2-3-10-18(16)20-12-6-1-7-15-13-25-14-26(15)20/h2-4,9-10,13-14,16,20H,1,5-8,11-12H2 |
| InChIKey | ODFYHMOKLWJVNN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |