About 5-ethyl-1,2,3-triiodobenzene
5-ethyl-1,2,3-triiodobenzene (PubChem CID 70822750) has the molecular formula C8H7I3
and a molecular weight of 483.86 g/mol. Its IUPAC name is 5-ethyl-1,2,3-triiodobenzene.
Molecular Properties
| Compound Name | 5-ethyl-1,2,3-triiodobenzene |
| PubChem CID | 70822750 |
| Molecular Formula | C8H7I3 |
| Molecular Weight | 483.86 g/mol |
| Exact Mass | 483.77 |
| IUPAC Name | 5-ethyl-1,2,3-triiodobenzene |
| SMILES | CCc1cc(I)c(I)c(I)c1 |
| InChI | InChI=1S/C8H7I3/c1-2-5-3-6(9)8(11)7(10)4-5/h3-4H,2H2,1H3 |
| InChIKey | NPCSAEQQXSAOJF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,2,3-triiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,2,3-triiodobenzene?
The IUPAC name of 5-ethyl-1,2,3-triiodobenzene (CID 70822750) is 5-ethyl-1,2,3-triiodobenzene.
What is the SMILES notation for 5-ethyl-1,2,3-triiodobenzene?
The canonical SMILES for 5-ethyl-1,2,3-triiodobenzene is CCc1cc(I)c(I)c(I)c1.
What is the InChIKey of 5-ethyl-1,2,3-triiodobenzene?
The InChIKey is NPCSAEQQXSAOJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7I3/c1-2-5-3-6(9)8(11)7(10)4-5/h3-4H,2H2,1H3.
What are the key properties of 5-ethyl-1,2,3-triiodobenzene?
5-ethyl-1,2,3-triiodobenzene has a molecular weight of 483.86 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,2,3-triiodobenzene is sourced from PubChem (CID 70822750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).