C10H16O4 — CID 70822839
(2,4,6-trimethoxycyclohexa-1,3-dien-1-yl)methanol (PubChem CID 70822839) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2,4,6-trimethoxycyclohexa-1,3-dien-1-yl)methanol.
| Compound Name | (2,4,6-trimethoxycyclohexa-1,3-dien-1-yl)methanol |
|---|---|
| PubChem CID | 70822839 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2,4,6-trimethoxycyclohexa-1,3-dien-1-yl)methanol |
| SMILES | COC1=CC(OC)=C(CO)C(OC)C1 |
| InChI | InChI=1S/C10H16O4/c1-12-7-4-9(13-2)8(6-11)10(5-7)14-3/h4,10-11H,5-6H2,1-3H3 |
| InChIKey | FLEDRHKKNDXGMS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |