C18H24N8O3S — CID 70823928
5-[[(3S,4R)-4-amino-3-(sulfamoylamino)piperidin-1-yl]methyl]-4-(3-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 70823928) has the molecular formula C18H24N8O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 5-[[(3S,4R)-4-amino-3-(sulfamoylamino)piperidin-1-yl]methyl]-4-(3-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 5-[[(3S,4R)-4-amino-3-(sulfamoylamino)piperidin-1-yl]methyl]-4-(3-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 70823928 |
| Molecular Formula | C18H24N8O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 5-[[(3S,4R)-4-amino-3-(sulfamoylamino)piperidin-1-yl]methyl]-4-(3-hydroxyanilino)pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | N[C@@H]1CCN(Cc2ccn3ncnc(Nc4cccc(O)c4)c23)C[C@@H]1NS(N)(=O)=O |
| InChI | InChI=1S/C18H24N8O3S/c19-15-5-6-25(10-16(15)24-30(20,28)29)9-12-4-7-26-17(12)18(21-11-22-26)23-13-2-1-3-14(27)8-13/h1-4,7-8,11,15-16,24,27H,5-6,9-10,19H2,(H2,20,28,29)(H,21,22,23)/t15-,16+/m1/s1 |
| InChIKey | BDTKMUUCCNJIBU-CVEARBPZSA-N |
| XLogP | -0.13 |
| TPSA | 163.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |