C12H19NO2 — CID 70823939
10-methoxy-5-methyl-2,3,4,6,9,10-hexahydro-1,5-benzoxazocine (PubChem CID 70823939) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 10-methoxy-5-methyl-2,3,4,6,9,10-hexahydro-1,5-benzoxazocine.
| Compound Name | 10-methoxy-5-methyl-2,3,4,6,9,10-hexahydro-1,5-benzoxazocine |
|---|---|
| PubChem CID | 70823939 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 10-methoxy-5-methyl-2,3,4,6,9,10-hexahydro-1,5-benzoxazocine |
| SMILES | COC1CC=CC2=C1OCCCN(C)C2 |
| InChI | InChI=1S/C12H19NO2/c1-13-7-4-8-15-12-10(9-13)5-3-6-11(12)14-2/h3,5,11H,4,6-9H2,1-2H3 |
| InChIKey | MFCHBIPBYZWIRI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |