C22H21N2O2S+ — CID 7082427
(1S,2S,7S,8S)-10-phenyl-7-[(E)-2-phenylethenyl]-4-thia-10-aza-6-azoniatricyclo[6.3.0.02,6]undecane-9,11-dione (PubChem CID 7082427) has the molecular formula C22H21N2O2S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is (1S,2S,7S,8S)-10-phenyl-7-[(E)-2-phenylethenyl]-4-thia-10-aza-6-azoniatricyclo[6.3.0.02,6]undecane-9,11-dione.
| Compound Name | (1S,2S,7S,8S)-10-phenyl-7-[(E)-2-phenylethenyl]-4-thia-10-aza-6-azoniatricyclo[6.3.0.02,6]undecane-9,11-dione |
|---|---|
| PubChem CID | 7082427 |
| Molecular Formula | C22H21N2O2S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (1S,2S,7S,8S)-10-phenyl-7-[(E)-2-phenylethenyl]-4-thia-10-aza-6-azoniatricyclo[6.3.0.02,6]undecane-9,11-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccccc1)[C@H](/C=C/c1ccccc1)[NH+]1CSC[C@H]21 |
| InChI | InChI=1S/C22H20N2O2S/c25-21-19-17(12-11-15-7-3-1-4-8-15)23-14-27-13-18(23)20(19)22(26)24(21)16-9-5-2-6-10-16/h1-12,17-20H,13-14H2/p+1/b12-11+/t17-,18+,19+,20+/m0/s1 |
| InChIKey | MBXWDSGZEQLRNI-AZXIPFKHSA-O |
| XLogP | 1.85 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|