C42H59N4OS+ — CID 70824518
[4-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]-ethylamino]-4-oxobutyl]-dimethyl-(2-methylsulfanylethyl)azanium (PubChem CID 70824518) has the molecular formula C42H59N4OS+ and a molecular weight of 668.03 g/mol. Its IUPAC name is [4-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]-ethylamino]-4-oxobutyl]-dimethyl-(2-methylsulfanylethyl)azanium.
| Compound Name | [4-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]-ethylamino]-4-oxobutyl]-dimethyl-(2-methylsulfanylethyl)azanium |
|---|---|
| PubChem CID | 70824518 |
| Molecular Formula | C42H59N4OS+ |
| Molecular Weight | 668.03 g/mol |
| Exact Mass | 667.44 |
| IUPAC Name | [4-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]-ethylamino]-4-oxobutyl]-dimethyl-(2-methylsulfanylethyl)azanium |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)C(=O)CCC[N+](C)(C)CCSC)c3ccccc23)cc1 |
| InChI | InChI=1S/C42H59N4OS/c1-9-43(10-2)35-24-20-33(21-25-35)42(34-22-26-36(27-23-34)44(11-3)12-4)39-28-29-40(38-18-15-14-17-37(38)39)45(13-5)41(47)19-16-30-46(6,7)31-32-48-8/h14-15,17-18,20-29,42H,9-13,16,19,30-32H2,1-8H3/q+1 |
| InChIKey | CARZGEQJIGMWER-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.03 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|