C14H24N2O4 — CID 70826442
(11E)-1,4-dioxa-7,16-diazacyclooctadec-11-ene-8,15-dione (PubChem CID 70826442) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is (11E)-1,4-dioxa-7,16-diazacyclooctadec-11-ene-8,15-dione.
| Compound Name | (11E)-1,4-dioxa-7,16-diazacyclooctadec-11-ene-8,15-dione |
|---|---|
| PubChem CID | 70826442 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (11E)-1,4-dioxa-7,16-diazacyclooctadec-11-ene-8,15-dione |
| SMILES | O=C1CC/C=C/CCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C14H24N2O4/c17-13-5-3-1-2-4-6-14(18)16-8-10-20-12-11-19-9-7-15-13/h1-2H,3-12H2,(H,15,17)(H,16,18)/b2-1+ |
| InChIKey | SYXFEASKWGRZGQ-OWOJBTEDSA-N |
| XLogP | 0.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|