C21H17ClO3S — CID 70826473
(1S,2R,6S,7R)-4-[5-(4-chlorophenyl)-2-ethylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 70826473) has the molecular formula C21H17ClO3S and a molecular weight of 384.88 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[5-(4-chlorophenyl)-2-ethylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[5-(4-chlorophenyl)-2-ethylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 70826473 |
| Molecular Formula | C21H17ClO3S |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (1S,2R,6S,7R)-4-[5-(4-chlorophenyl)-2-ethylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCc1sc(-c2ccc(Cl)cc2)cc1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C21H17ClO3S/c1-2-15-12(9-16(26-15)10-3-5-11(22)6-4-10)17-20(23)18-13-7-8-14(25-13)19(18)21(17)24/h3-9,13-14,17-19H,2H2,1H3/t13-,14+,17?,18-,19+ |
| InChIKey | LUNSGAYLPZHJML-FVCIXVNCSA-N |
| XLogP | 4.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|