C19H16ClNO3S — CID 70826513
(1S,2R,6S,7R)-4-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 70826513) has the molecular formula C19H16ClNO3S and a molecular weight of 373.86 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 70826513 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (1S,2R,6S,7R)-4-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C19H16ClNO3S/c1-8-18(25-19(21-8)9-2-4-10(20)5-3-9)15-16(22)13-11-6-7-12(24-11)14(13)17(15)23/h2-5,11-15H,6-7H2,1H3/t11-,12+,13-,14+,15? |
| InChIKey | DZDKVNZBZSEAFS-RRIFHVCJSA-N |
| XLogP | 3.80 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|