C26H39F3N4O7S — CID 70826794
tert-butyl N-[(1S,4R,6S,7Z)-2,17-dioxo-4-(trifluoromethylsulfonylcarbamoyl)-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate (PubChem CID 70826794) has the molecular formula C26H39F3N4O7S and a molecular weight of 608.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,7Z)-2,17-dioxo-4-(trifluoromethylsulfonylcarbamoyl)-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,7Z)-2,17-dioxo-4-(trifluoromethylsulfonylcarbamoyl)-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
|---|---|
| PubChem CID | 70826794 |
| Molecular Formula | C26H39F3N4O7S |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,7Z)-2,17-dioxo-4-(trifluoromethylsulfonylcarbamoyl)-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C(F)(F)F)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C26H39F3N4O7S/c1-24(2,3)40-23(37)30-18-13-10-8-6-4-5-7-9-12-17-16-25(17,22(36)32-41(38,39)26(27,28)29)31-20(34)19-14-11-15-33(19)21(18)35/h9,12,17-19H,4-8,10-11,13-16H2,1-3H3,(H,30,37)(H,31,34)(H,32,36)/b12-9-/t17-,18?,19+,25-/m1/s1 |
| InChIKey | ULHHIKRFZFCSCN-HFOXXTAJSA-N |
| XLogP | 3.01 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|