C27H41N3O — CID 70827317
1-cyclohexyl-N-(6,8,8-trimethyl-7-tricyclo[4.2.0.01,3]octanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide (PubChem CID 70827317) has the molecular formula C27H41N3O and a molecular weight of 423.65 g/mol. Its IUPAC name is 1-cyclohexyl-N-(6,8,8-trimethyl-7-tricyclo[4.2.0.01,3]octanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide.
| Compound Name | 1-cyclohexyl-N-(6,8,8-trimethyl-7-tricyclo[4.2.0.01,3]octanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 70827317 |
| Molecular Formula | C27H41N3O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | 1-cyclohexyl-N-(6,8,8-trimethyl-7-tricyclo[4.2.0.01,3]octanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide |
| SMILES | CC1(C)C(NC(=O)c2nn(C3CCCCC3)c3c2CCCCCC3)C2(C)CCC3CC312 |
| InChI | InChI=1S/C27H41N3O/c1-25(2)24(26(3)16-15-18-17-27(18,25)26)28-23(31)22-20-13-9-4-5-10-14-21(20)30(29-22)19-11-7-6-8-12-19/h18-19,24H,4-17H2,1-3H3,(H,28,31) |
| InChIKey | XSAZDHAAONOLFR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |