C17H24O6S — CID 70827521
methyl (3S,6S)-4-butoxy-3,5-dihydroxy-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 70827521) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is methyl (3S,6S)-4-butoxy-3,5-dihydroxy-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (3S,6S)-4-butoxy-3,5-dihydroxy-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 70827521 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl (3S,6S)-4-butoxy-3,5-dihydroxy-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | CCCCOC1C(O)[C@H](Sc2ccccc2)OC(C(=O)OC)[C@H]1O |
| InChI | InChI=1S/C17H24O6S/c1-3-4-10-22-14-12(18)15(16(20)21-2)23-17(13(14)19)24-11-8-6-5-7-9-11/h5-9,12-15,17-19H,3-4,10H2,1-2H3/t12-,13?,14?,15?,17-/m0/s1 |
| InChIKey | FWTLVKQMULXQFB-UIHSVCCWSA-N |
| XLogP | 1.58 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|