About 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol
2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol (PubChem CID 70828694) has the molecular formula C16H17N3OS
and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol |
| PubChem CID | 70828694 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol |
| SMILES | CN(C)c1ccc(-c2nc3ccc(CCO)nc3s2)cc1 |
| InChI | InChI=1S/C16H17N3OS/c1-19(2)13-6-3-11(4-7-13)15-18-14-8-5-12(9-10-20)17-16(14)21-15/h3-8,20H,9-10H2,1-2H3 |
| InChIKey | ASKPAZYQALHTGB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol?
The IUPAC name of 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol (CID 70828694) is 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol.
What is the SMILES notation for 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol?
The canonical SMILES for 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol is CN(C)c1ccc(-c2nc3ccc(CCO)nc3s2)cc1.
What is the InChIKey of 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol?
The InChIKey is ASKPAZYQALHTGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3OS/c1-19(2)13-6-3-11(4-7-13)15-18-14-8-5-12(9-10-20)17-16(14)21-15/h3-8,20H,9-10H2,1-2H3.
What are the key properties of 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol?
2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol has a molecular weight of 299.40 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(dimethylamino)phenyl]-[1,3]thiazolo[5,4-b]pyridin-5-yl]ethanol is sourced from PubChem (CID 70828694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).