C16H26F3N3O — CID 70829026
2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 70829026) has the molecular formula C16H26F3N3O and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 70829026 |
| Molecular Formula | C16H26F3N3O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-(9,9,9-trifluorononyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | O=C1NC(CCCCCCCCC(F)(F)F)=NC12CCNCC2 |
| InChI | InChI=1S/C16H26F3N3O/c17-16(18,19)8-6-4-2-1-3-5-7-13-21-14(23)15(22-13)9-11-20-12-10-15/h20H,1-12H2,(H,21,22,23) |
| InChIKey | HRFAFMMMDQAPKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|