C22H26FN7O3S — CID 70829282
8-fluoro-N-[(1S)-1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-8,9-dihydro-7H-purin-6-amine (PubChem CID 70829282) has the molecular formula C22H26FN7O3S and a molecular weight of 487.56 g/mol. Its IUPAC name is 8-fluoro-N-[(1S)-1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-8,9-dihydro-7H-purin-6-amine.
| Compound Name | 8-fluoro-N-[(1S)-1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-8,9-dihydro-7H-purin-6-amine |
|---|---|
| PubChem CID | 70829282 |
| Molecular Formula | C22H26FN7O3S |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 8-fluoro-N-[(1S)-1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-8,9-dihydro-7H-purin-6-amine |
| SMILES | C[C@H](Nc1ncnc2c1NC(F)N2)c1cc2ccccc2c(OC2CCN(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C22H26FN7O3S/c1-13(26-19-18-20(25-12-24-19)29-22(23)28-18)17-11-14-5-3-4-6-16(14)21(27-17)33-15-7-9-30(10-8-15)34(2,31)32/h3-6,11-13,15,22,28H,7-10H2,1-2H3,(H2,24,25,26,29)/t13-,22?/m0/s1 |
| InChIKey | LHCVJLGPCPBPAG-JHAYDQECSA-N |
| XLogP | 3.09 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|