C14H22N4O2S2 — CID 70829342
2-amino-6-[4,5-dihydro-1,3-thiazol-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]hexanoic acid (PubChem CID 70829342) has the molecular formula C14H22N4O2S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-amino-6-[4,5-dihydro-1,3-thiazol-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]hexanoic acid.
| Compound Name | 2-amino-6-[4,5-dihydro-1,3-thiazol-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 70829342 |
| Molecular Formula | C14H22N4O2S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-amino-6-[4,5-dihydro-1,3-thiazol-2-ylmethyl(1,3-thiazol-2-ylmethyl)amino]hexanoic acid |
| SMILES | NC(CCCCN(CC1=NCCS1)Cc1nccs1)C(=O)O |
| InChI | InChI=1S/C14H22N4O2S2/c15-11(14(19)20)3-1-2-6-18(9-12-16-4-7-21-12)10-13-17-5-8-22-13/h4,7,11H,1-3,5-6,8-10,15H2,(H,19,20) |
| InChIKey | PDEJCSSSQAROKO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|