C40H26N4OS2 — CID 70829956
2-[4-[4,6-bis(4-phenylsulfanylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 70829956) has the molecular formula C40H26N4OS2 and a molecular weight of 642.81 g/mol. Its IUPAC name is 2-[4-[4,6-bis(4-phenylsulfanylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4,6-bis(4-phenylsulfanylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70829956 |
| Molecular Formula | C40H26N4OS2 |
| Molecular Weight | 642.81 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 2-[4-[4,6-bis(4-phenylsulfanylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(Sc2ccc(-c3nc(-c4ccc(Sc5ccccc5)cc4)nc(-c4ccc(-c5nc6ccccc6o5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C40H26N4OS2/c1-3-9-31(10-4-1)46-33-23-19-28(20-24-33)38-42-37(27-15-17-30(18-16-27)40-41-35-13-7-8-14-36(35)45-40)43-39(44-38)29-21-25-34(26-22-29)47-32-11-5-2-6-12-32/h1-26H |
| InChIKey | QDASDYZEAQQNPG-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.81 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |