C46H34N4O — CID 70829972
2-[4-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 70829972) has the molecular formula C46H34N4O and a molecular weight of 658.81 g/mol. Its IUPAC name is 2-[4-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70829972 |
| Molecular Formula | C46H34N4O |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 2-[4-[4,6-bis(9,9-dimethylfluoren-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccc(-c5nc6ccccc6o5)cc4)nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)n3)cc21 |
| InChI | InChI=1S/C46H34N4O/c1-45(2)35-13-7-5-11-31(35)33-23-21-29(25-37(33)45)42-48-41(27-17-19-28(20-18-27)44-47-39-15-9-10-16-40(39)51-44)49-43(50-42)30-22-24-34-32-12-6-8-14-36(32)46(3,4)38(34)26-30/h5-26H,1-4H3 |
| InChIKey | BISXITAAPBQUOR-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |