C32H18N8O — CID 70830017
2-[4-[4,6-di(quinoxalin-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 70830017) has the molecular formula C32H18N8O and a molecular weight of 530.55 g/mol. Its IUPAC name is 2-[4-[4,6-di(quinoxalin-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4,6-di(quinoxalin-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70830017 |
| Molecular Formula | C32H18N8O |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 2-[4-[4,6-di(quinoxalin-2-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2nc(-c3nc(-c4ccc(-c5nc6ccccc6o5)cc4)nc(-c4cnc5ccccc5n4)n3)cnc2c1 |
| InChI | InChI=1S/C32H18N8O/c1-3-9-23-21(7-1)33-17-26(35-23)30-38-29(39-31(40-30)27-18-34-22-8-2-4-10-24(22)36-27)19-13-15-20(16-14-19)32-37-25-11-5-6-12-28(25)41-32/h1-18H |
| InChIKey | ZXIWCOWPMHLABX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 116.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |