C28H16F2N4O — CID 70830023
2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 70830023) has the molecular formula C28H16F2N4O and a molecular weight of 462.46 g/mol. Its IUPAC name is 2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70830023 |
| Molecular Formula | C28H16F2N4O |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | Fc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(-c4nc5ccccc5o4)cc3)n2)cc1 |
| InChI | InChI=1S/C28H16F2N4O/c29-21-13-9-18(10-14-21)26-32-25(33-27(34-26)19-11-15-22(30)16-12-19)17-5-7-20(8-6-17)28-31-23-3-1-2-4-24(23)35-28/h1-16H |
| InChIKey | DCJMYKDNCOWNPA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |