C36H28N6O — CID 70830027
2-[4-[4-(1-cyclohexa-1,3-dien-1-ylpyrrol-2-yl)-6-(1-phenyl-2,3-dihydropyrrol-5-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 70830027) has the molecular formula C36H28N6O and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-[4-[4-(1-cyclohexa-1,3-dien-1-ylpyrrol-2-yl)-6-(1-phenyl-2,3-dihydropyrrol-5-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4-(1-cyclohexa-1,3-dien-1-ylpyrrol-2-yl)-6-(1-phenyl-2,3-dihydropyrrol-5-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70830027 |
| Molecular Formula | C36H28N6O |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-[4-[4-(1-cyclohexa-1,3-dien-1-ylpyrrol-2-yl)-6-(1-phenyl-2,3-dihydropyrrol-5-yl)-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | C1=CCCC(n2cccc2-c2nc(C3=CCCN3c3ccccc3)nc(-c3ccc(-c4nc5ccccc5o4)cc3)n2)=C1 |
| InChI | InChI=1S/C36H28N6O/c1-3-11-27(12-4-1)41-23-9-16-30(41)34-38-33(39-35(40-34)31-17-10-24-42(31)28-13-5-2-6-14-28)25-19-21-26(22-20-25)36-37-29-15-7-8-18-32(29)43-36/h1-5,7-8,10-13,15-22,24H,6,9,14,23H2 |
| InChIKey | XNIAWQXAWOPZJH-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |