C52H36N6O — CID 70830028
2-[4-[4-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]-6-[4-(3,4-dihydrocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 70830028) has the molecular formula C52H36N6O and a molecular weight of 760.90 g/mol. Its IUPAC name is 2-[4-[4-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]-6-[4-(3,4-dihydrocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[4-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]-6-[4-(3,4-dihydrocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 70830028 |
| Molecular Formula | C52H36N6O |
| Molecular Weight | 760.90 g/mol |
| Exact Mass | 760.30 |
| IUPAC Name | 2-[4-[4-[4-(4a,9a-dihydrocarbazol-9-yl)phenyl]-6-[4-(3,4-dihydrocarbazol-9-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | C1=CC2c3ccccc3N(c3ccc(-c4nc(-c5ccc(-c6nc7ccccc7o6)cc5)nc(-c5ccc(-n6c7c(c8ccccc86)CCC=C7)cc5)n4)cc3)C2C=C1 |
| InChI | InChI=1S/C52H36N6O/c1-6-16-44-39(11-1)40-12-2-7-17-45(40)57(44)37-29-25-34(26-30-37)50-54-49(33-21-23-36(24-22-33)52-53-43-15-5-10-20-48(43)59-52)55-51(56-50)35-27-31-38(32-28-35)58-46-18-8-3-13-41(46)42-14-4-9-19-47(42)58/h1-3,5-13,15-32,39,44H,4,14H2 |
| InChIKey | UMVVLLNQMOXHTH-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.90 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |