About CID 70830093
CID 70830093 (PubChem CID 70830093) has the molecular formula C25H26BN8O4
and a molecular weight of 513.35 g/mol.
Molecular Properties
| Compound Name | CID 70830093 |
| PubChem CID | 70830093 |
| Molecular Formula | C25H26BN8O4 |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | — |
| SMILES | COc1cc2c(cc1OC)CN(c1nccc(C(=O)Nc3cnccc3-n3cc(C[B]OCN)cn3)n1)C2 |
| InChI | InChI=1S/C25H26BN8O4/c1-36-22-7-17-13-33(14-18(17)8-23(22)37-2)25-29-6-3-19(32-25)24(35)31-20-11-28-5-4-21(20)34-12-16(10-30-34)9-26-38-15-27/h3-8,10-12H,9,13-15,27H2,1-2H3,(H,31,35) |
| InChIKey | GVOOYNYGAZKDQS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 70830093 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70830093?
The IUPAC name of CID 70830093 (CID 70830093) is not available.
What is the SMILES notation for CID 70830093?
The canonical SMILES for CID 70830093 is COc1cc2c(cc1OC)CN(c1nccc(C(=O)Nc3cnccc3-n3cc(C[B]OCN)cn3)n1)C2.
What is the InChIKey of CID 70830093?
The InChIKey is GVOOYNYGAZKDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26BN8O4/c1-36-22-7-17-13-33(14-18(17)8-23(22)37-2)25-29-6-3-19(32-25)24(35)31-20-11-28-5-4-21(20)34-12-16(10-30-34)9-26-38-15-27/h3-8,10-12H,9,13-15,27H2,1-2H3,(H,31,35).
What are the key properties of CID 70830093?
CID 70830093 has a molecular weight of 513.35 g/mol, XLogP of 1.90, 10 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70830093 is sourced from PubChem (CID 70830093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).