About (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate
(7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate (PubChem CID 70830144) has the molecular formula C18H30O5
and a molecular weight of 326.43 g/mol. Its IUPAC name is (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate |
| PubChem CID | 70830144 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate |
| SMILES | COC1C2C(C)CCC2C2(C)OC1(C(C)C)CC2OC(=O)CO |
| InChI | InChI=1S/C18H30O5/c1-10(2)18-8-13(22-14(20)9-19)17(4,23-18)12-7-6-11(3)15(12)16(18)21-5/h10-13,15-16,19H,6-9H2,1-5H3 |
| InChIKey | BVRZMQGXJNVPSV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate?
The IUPAC name of (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate (CID 70830144) is (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate.
What is the SMILES notation for (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate?
The canonical SMILES for (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate is COC1C2C(C)CCC2C2(C)OC1(C(C)C)CC2OC(=O)CO.
What is the InChIKey of (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate?
The InChIKey is BVRZMQGXJNVPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O5/c1-10(2)18-8-13(22-14(20)9-19)17(4,23-18)12-7-6-11(3)15(12)16(18)21-5/h10-13,15-16,19H,6-9H2,1-5H3.
What are the key properties of (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate?
(7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate has a molecular weight of 326.43 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undecan-10-yl) 2-hydroxyacetate is sourced from PubChem (CID 70830144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).