About 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one
7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one (PubChem CID 70830544) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one.
Molecular Properties
| Compound Name | 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one |
| PubChem CID | 70830544 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one |
| SMILES | CC1(C)C=CC2=C(C=C1)SCC(=O)N2 |
| InChI | InChI=1S/C11H13NOS/c1-11(2)5-3-8-9(4-6-11)14-7-10(13)12-8/h3-6H,7H2,1-2H3,(H,12,13) |
| InChIKey | BTFUPXXXTZTMHG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one?
The IUPAC name of 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one (CID 70830544) is 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one.
What is the SMILES notation for 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one?
The canonical SMILES for 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one is CC1(C)C=CC2=C(C=C1)SCC(=O)N2.
What is the InChIKey of 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one?
The InChIKey is BTFUPXXXTZTMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-11(2)5-3-8-9(4-6-11)14-7-10(13)12-8/h3-6H,7H2,1-2H3,(H,12,13).
What are the key properties of 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one?
7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one has a molecular weight of 207.30 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-4H-cyclohepta[b][1,4]thiazin-3-one is sourced from PubChem (CID 70830544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).