C21H33N3O4 — CID 70830760
ethyl 2-[3-ethoxy-5-methyl-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]acetate (PubChem CID 70830760) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethyl 2-[3-ethoxy-5-methyl-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]acetate.
| Compound Name | ethyl 2-[3-ethoxy-5-methyl-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 70830760 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethyl 2-[3-ethoxy-5-methyl-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(OCC)c(N[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)c(C)c1=O |
| InChI | InChI=1S/C21H33N3O4/c1-7-27-17(25)11-24-20(26)13(4)18(19(23-24)28-8-2)22-16-10-14-9-15(12(16)3)21(14,5)6/h12,14-16,22H,7-11H2,1-6H3/t12-,14+,15-,16-/m1/s1 |
| InChIKey | PKYDHSCZODMDTR-SLBVQIDZSA-N |
| XLogP | 3.00 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |