C11H21B2IO4 — CID 70830825
2-(4-iodo-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70830825) has the molecular formula C11H21B2IO4 and a molecular weight of 365.81 g/mol. Its IUPAC name is 2-(4-iodo-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-iodo-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70830825 |
| Molecular Formula | C11H21B2IO4 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-(4-iodo-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(I)O2)OC1(C)C |
| InChI | InChI=1S/C11H21B2IO4/c1-8(2)9(3,4)16-12(15-8)13-17-10(5,6)11(7,14)18-13/h1-7H3 |
| InChIKey | DEELVPMHEHUKRU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|