C24H28BrF3N4O2 — CID 70830865
2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 70830865) has the molecular formula C24H28BrF3N4O2 and a molecular weight of 541.41 g/mol. Its IUPAC name is 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 70830865 |
| Molecular Formula | C24H28BrF3N4O2 |
| Molecular Weight | 541.41 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-[5-bromo-6-oxo-4-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-1-yl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1Nc1cnn(CC(=O)NCc3ccc(C(F)(F)F)cc3)c(=O)c1Br)C2(C)C |
| InChI | InChI=1S/C24H28BrF3N4O2/c1-13-17-8-16(23(17,2)3)9-18(13)31-19-11-30-32(22(34)21(19)25)12-20(33)29-10-14-4-6-15(7-5-14)24(26,27)28/h4-7,11,13,16-18,31H,8-10,12H2,1-3H3,(H,29,33)/t13-,16+,17-,18-/m1/s1 |
| InChIKey | QDVRXGSOSLVJHE-BVPBIZIASA-N |
| XLogP | 4.82 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |