C24H33N5O3 — CID 70830956
2-[3,4-dioxo-5-[[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-2-yl]-N-(1-pyridin-4-ylpropyl)acetamide (PubChem CID 70830956) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[3,4-dioxo-5-[[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-2-yl]-N-(1-pyridin-4-ylpropyl)acetamide.
| Compound Name | 2-[3,4-dioxo-5-[[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-2-yl]-N-(1-pyridin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 70830956 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 2-[3,4-dioxo-5-[[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]-1H-pyridazin-2-yl]-N-(1-pyridin-4-ylpropyl)acetamide |
| SMILES | CCC(NC(=O)Cn1[nH]cc(NC2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)c(=O)c1=O)c1ccncc1 |
| InChI | InChI=1S/C24H33N5O3/c1-5-18(15-6-8-25-9-7-15)28-21(30)13-29-23(32)22(31)20(12-26-29)27-19-11-16-10-17(14(19)2)24(16,3)4/h6-9,12,14,16-19,26-27H,5,10-11,13H2,1-4H3,(H,28,30)/t14-,16+,17-,18?,19?/m1/s1 |
| InChIKey | FBGXNYANGTWDQS-LIDAOFKCSA-N |
| XLogP | 2.68 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|