C21H21NO5 — CID 70831135
13-ethyl-2,3-dihydroxy-9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 70831135) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 13-ethyl-2,3-dihydroxy-9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | 13-ethyl-2,3-dihydroxy-9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 70831135 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 13-ethyl-2,3-dihydroxy-9,10-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | CCc1c2n(c(=O)c3c(OC)c(OC)ccc13)CCc1cc(O)c(O)cc1-2 |
| InChI | InChI=1S/C21H21NO5/c1-4-12-13-5-6-17(26-2)20(27-3)18(13)21(25)22-8-7-11-9-15(23)16(24)10-14(11)19(12)22/h5-6,9-10,23-24H,4,7-8H2,1-3H3 |
| InChIKey | KCWVDBQEKWDVQL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|