C22H24FN7S — CID 70831737
1-[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]-1-(2-piperidin-1-ylethyl)hydrazine (PubChem CID 70831737) has the molecular formula C22H24FN7S and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]-1-(2-piperidin-1-ylethyl)hydrazine.
| Compound Name | 1-[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]-1-(2-piperidin-1-ylethyl)hydrazine |
|---|---|
| PubChem CID | 70831737 |
| Molecular Formula | C22H24FN7S |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]-1-(2-piperidin-1-ylethyl)hydrazine |
| SMILES | NN(CCN1CCCCC1)c1nccc(-c2c(-c3ccc(F)cc3)nc3sccn23)n1 |
| InChI | InChI=1S/C22H24FN7S/c23-17-6-4-16(5-7-17)19-20(29-14-15-31-22(29)27-19)18-8-9-25-21(26-18)30(24)13-12-28-10-2-1-3-11-28/h4-9,14-15H,1-3,10-13,24H2 |
| InChIKey | BBAQNRWFQIGBCJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|