About 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran
6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran (PubChem CID 70831990) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran.
Molecular Properties
| Compound Name | 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran |
| PubChem CID | 70831990 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran |
| SMILES | CCc1cc2cc3cc(C(C)C)oc3cc2o1 |
| InChI | InChI=1S/C15H16O2/c1-4-12-6-10-5-11-7-13(9(2)3)17-15(11)8-14(10)16-12/h5-9H,4H2,1-3H3 |
| InChIKey | NNJOTUSIFRNWOA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran?
The IUPAC name of 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran (CID 70831990) is 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran.
What is the SMILES notation for 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran?
The canonical SMILES for 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran is CCc1cc2cc3cc(C(C)C)oc3cc2o1.
What is the InChIKey of 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran?
The InChIKey is NNJOTUSIFRNWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-4-12-6-10-5-11-7-13(9(2)3)17-15(11)8-14(10)16-12/h5-9H,4H2,1-3H3.
What are the key properties of 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran?
6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran has a molecular weight of 228.29 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-propan-2-ylfuro[3,2-f][1]benzofuran is sourced from PubChem (CID 70831990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).