C18H14FIN4S — CID 70832082
N-(4-fluorophenyl)-6-(3-iodo-4-pyridinyl)-2,3-dimethylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 70832082) has the molecular formula C18H14FIN4S and a molecular weight of 464.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-(3-iodo-4-pyridinyl)-2,3-dimethylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | N-(4-fluorophenyl)-6-(3-iodo-4-pyridinyl)-2,3-dimethylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 70832082 |
| Molecular Formula | C18H14FIN4S |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | N-(4-fluorophenyl)-6-(3-iodo-4-pyridinyl)-2,3-dimethylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Cc1sc2nc(-c3ccncc3I)c(Nc3ccc(F)cc3)n2c1C |
| InChI | InChI=1S/C18H14FIN4S/c1-10-11(2)25-18-23-16(14-7-8-21-9-15(14)20)17(24(10)18)22-13-5-3-12(19)4-6-13/h3-9,22H,1-2H3 |
| InChIKey | UROPERWRZRPPSU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|