C25H19FIN3S — CID 70832151
N-(2,6-dimethylphenyl)-6-(2-fluoro-6-iodophenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 70832151) has the molecular formula C25H19FIN3S and a molecular weight of 539.42 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-6-(2-fluoro-6-iodophenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | N-(2,6-dimethylphenyl)-6-(2-fluoro-6-iodophenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 70832151 |
| Molecular Formula | C25H19FIN3S |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | N-(2,6-dimethylphenyl)-6-(2-fluoro-6-iodophenyl)-3-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Cc1cccc(C)c1Nc1c(-c2c(F)cccc2I)nc2scc(-c3ccccc3)n12 |
| InChI | InChI=1S/C25H19FIN3S/c1-15-8-6-9-16(2)22(15)28-24-23(21-18(26)12-7-13-19(21)27)29-25-30(24)20(14-31-25)17-10-4-3-5-11-17/h3-14,28H,1-2H3 |
| InChIKey | RYBGFLBMCGSMDG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|