About 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline
7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline (PubChem CID 70832201) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline.
Molecular Properties
| Compound Name | 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline |
| PubChem CID | 70832201 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline |
| SMILES | Cc1ccc2c(c1)=CC1CC(C(C)C)=CN=C1C=2 |
| InChI | InChI=1S/C17H19N/c1-11(2)16-8-15-7-14-6-12(3)4-5-13(14)9-17(15)18-10-16/h4-7,9-11,15H,8H2,1-3H3 |
| InChIKey | ZZLKERISTDGPMX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline?
The IUPAC name of 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline (CID 70832201) is 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline.
What is the SMILES notation for 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline?
The canonical SMILES for 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline is Cc1ccc2c(c1)=CC1CC(C(C)C)=CN=C1C=2.
What is the InChIKey of 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline?
The InChIKey is ZZLKERISTDGPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-11(2)16-8-15-7-14-6-12(3)4-5-13(14)9-17(15)18-10-16/h4-7,9-11,15H,8H2,1-3H3.
What are the key properties of 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline?
7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline has a molecular weight of 237.35 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-propan-2-yl-4,4a-dihydrobenzo[g]quinoline is sourced from PubChem (CID 70832201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).