About 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one
4-anilino-3-ethyl-1H-1,2,4-triazol-5-one (PubChem CID 708326) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one |
| PubChem CID | 708326 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one |
| SMILES | CCc1n[nH]c(=O)n1Nc1ccccc1 |
| InChI | InChI=1S/C10H12N4O/c1-2-9-11-12-10(15)14(9)13-8-6-4-3-5-7-8/h3-7,13H,2H2,1H3,(H,12,15) |
| InChIKey | WHGZZMJNVIDLRI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one (CID 708326) is 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one is CCc1n[nH]c(=O)n1Nc1ccccc1.
What is the InChIKey of 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one?
The InChIKey is WHGZZMJNVIDLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-2-9-11-12-10(15)14(9)13-8-6-4-3-5-7-8/h3-7,13H,2H2,1H3,(H,12,15).
What are the key properties of 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one?
4-anilino-3-ethyl-1H-1,2,4-triazol-5-one has a molecular weight of 204.23 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-3-ethyl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 708326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).