About 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene
1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene (PubChem CID 70832812) has the molecular formula C10H10BrF3
and a molecular weight of 267.09 g/mol. Its IUPAC name is 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene |
| PubChem CID | 70832812 |
| Molecular Formula | C10H10BrF3 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene |
| SMILES | CCc1ccc(Br)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C10H10BrF3/c1-2-7-3-4-9(11)8(5-7)6-10(12,13)14/h3-5H,2,6H2,1H3 |
| InChIKey | YQFXDTDYXNBOAG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene?
The IUPAC name of 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene (CID 70832812) is 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene.
What is the SMILES notation for 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene?
The canonical SMILES for 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene is CCc1ccc(Br)c(CC(F)(F)F)c1.
What is the InChIKey of 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene?
The InChIKey is YQFXDTDYXNBOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrF3/c1-2-7-3-4-9(11)8(5-7)6-10(12,13)14/h3-5H,2,6H2,1H3.
What are the key properties of 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene?
1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene has a molecular weight of 267.09 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethyl-2-(2,2,2-trifluoroethyl)benzene is sourced from PubChem (CID 70832812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).