About 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane
8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane (PubChem CID 70833001) has the molecular formula C15H19FO2
and a molecular weight of 250.31 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 70833001 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1(c2ccc(F)cc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H19FO2/c1-14(12-2-4-13(16)5-3-12)6-8-15(9-7-14)17-10-11-18-15/h2-5H,6-11H2,1H3 |
| InChIKey | MJZJAMCTMHZBBZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane (CID 70833001) is 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane is CC1(c2ccc(F)cc2)CCC2(CC1)OCCO2.
What is the InChIKey of 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is MJZJAMCTMHZBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO2/c1-14(12-2-4-13(16)5-3-12)6-8-15(9-7-14)17-10-11-18-15/h2-5H,6-11H2,1H3.
What are the key properties of 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane?
8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 250.31 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-fluorophenyl)-8-methyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 70833001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).